C20H16N4OS2 — CID 7559806
(5E)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(naphthalen-1-ylmethylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 7559806) has the molecular formula C20H16N4OS2 and a molecular weight of 392.51 g/mol. Its IUPAC name is (5E)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(naphthalen-1-ylmethylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(naphthalen-1-ylmethylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7559806 |
| Molecular Formula | C20H16N4OS2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (5E)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(naphthalen-1-ylmethylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2cccc3ccccc23)SC1=Nc1nnc(C)s1 |
| InChI | InChI=1S/C20H16N4OS2/c1-3-11-24-18(25)17(27-20(24)21-19-23-22-13(2)26-19)12-15-9-6-8-14-7-4-5-10-16(14)15/h3-10,12H,1,11H2,2H3/b17-12+,21-20? |
| InChIKey | YRMZUQUQJZIJHK-DBOKLQOQSA-N |
| XLogP | 4.79 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|