C21H18N4O3S2 — CID 18846024
(2E,5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 18846024) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (2E,5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18846024 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (2E,5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(/C=C2\S/C(=N/c3nnc(C)s3)N(c3ccccc3)C2=O)c1OC |
| InChI | InChI=1S/C21H18N4O3S2/c1-13-23-24-20(29-13)22-21-25(15-9-5-4-6-10-15)19(26)17(30-21)12-14-8-7-11-16(27-2)18(14)28-3/h4-12H,1-3H3/b17-12-,22-21+ |
| InChIKey | KBAHMQHOSIJFSH-PJTLKFSUSA-N |
| XLogP | 4.67 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|