C15H12N4O3S2 — CID 43861776
2-[(E)-[(2E)-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 43861776) has the molecular formula C15H12N4O3S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[(E)-[(2E)-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[(2E)-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 43861776 |
| Molecular Formula | C15H12N4O3S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[(E)-[(2E)-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | Cc1nnc(/N=C2/S/C(=C/c3ccccc3C(=O)O)C(=O)N2C)s1 |
| InChI | InChI=1S/C15H12N4O3S2/c1-8-17-18-14(23-8)16-15-19(2)12(20)11(24-15)7-9-5-3-4-6-10(9)13(21)22/h3-7H,1-2H3,(H,21,22)/b11-7+,16-15+ |
| InChIKey | FHKMFJSMVQDWKU-BTTWLWSCSA-N |
| XLogP | 2.78 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|