C15H11N4O3S2- — CID 7730077
4-[(Z)-[3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 7730077) has the molecular formula C15H11N4O3S2- and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-[(Z)-[3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | 4-[(Z)-[3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 7730077 |
| Molecular Formula | C15H11N4O3S2- |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 4-[(Z)-[3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | Cc1nnc(N=C2S/C(=C\c3ccc(C(=O)[O-])cc3)C(=O)N2C)s1 |
| InChI | InChI=1S/C15H12N4O3S2/c1-8-17-18-14(23-8)16-15-19(2)12(20)11(24-15)7-9-3-5-10(6-4-9)13(21)22/h3-7H,1-2H3,(H,21,22)/p-1/b11-7-,16-15? |
| InChIKey | RLDGPEBEYRHSLZ-VCHKQBRCSA-M |
| XLogP | 1.44 |
| TPSA | 98.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|