C19H20N4O4S2 — CID 43862146
2-[4-[(E)-[(2E)-3-ethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid (PubChem CID 43862146) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[4-[(E)-[(2E)-3-ethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid.
| Compound Name | 2-[4-[(E)-[(2E)-3-ethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 43862146 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[4-[(E)-[(2E)-3-ethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(/C=C2/S/C(=N/c3nnc(C)s3)N(CC)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C19H20N4O4S2/c1-4-14(17(25)26)27-13-8-6-12(7-9-13)10-15-16(24)23(5-2)19(29-15)20-18-22-21-11(3)28-18/h6-10,14H,4-5H2,1-3H3,(H,25,26)/b15-10+,20-19+ |
| InChIKey | LVKAIYYXBFLITP-ZMYKUUMVSA-N |
| XLogP | 3.71 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|