C17H16N4O4S2 — CID 43862526
2-[3-[(E)-[(2E)-3-ethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 43862526) has the molecular formula C17H16N4O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[3-[(E)-[(2E)-3-ethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(E)-[(2E)-3-ethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 43862526 |
| Molecular Formula | C17H16N4O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-[3-[(E)-[(2E)-3-ethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCN1C(=O)/C(=C\c2cccc(OCC(=O)O)c2)S/C1=N/c1nnc(C)s1 |
| InChI | InChI=1S/C17H16N4O4S2/c1-3-21-15(24)13(27-17(21)18-16-20-19-10(2)26-16)8-11-5-4-6-12(7-11)25-9-14(22)23/h4-8H,3,9H2,1-2H3,(H,22,23)/b13-8+,18-17+ |
| InChIKey | NNTUPTUZZSTKCO-MUXWPUSVSA-N |
| XLogP | 2.93 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|