C14H15N5OS2 — CID 18845863
(2E,5E)-3-ethyl-5-[(1-methylpyrrol-2-yl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 18845863) has the molecular formula C14H15N5OS2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (2E,5E)-3-ethyl-5-[(1-methylpyrrol-2-yl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-ethyl-5-[(1-methylpyrrol-2-yl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845863 |
| Molecular Formula | C14H15N5OS2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (2E,5E)-3-ethyl-5-[(1-methylpyrrol-2-yl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cccn2C)S/C1=N/c1nnc(C)s1 |
| InChI | InChI=1S/C14H15N5OS2/c1-4-19-12(20)11(8-10-6-5-7-18(10)3)22-14(19)15-13-17-16-9(2)21-13/h5-8H,4H2,1-3H3/b11-8+,15-14+ |
| InChIKey | MRHTVNCPJUISCB-IIXCLMFLSA-N |
| XLogP | 2.81 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|