C18H17N5OS2 — CID 18845856
(2E,5Z)-3-ethyl-5-[(1-methylindol-3-yl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 18845856) has the molecular formula C18H17N5OS2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (2E,5Z)-3-ethyl-5-[(1-methylindol-3-yl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-ethyl-5-[(1-methylindol-3-yl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845856 |
| Molecular Formula | C18H17N5OS2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (2E,5Z)-3-ethyl-5-[(1-methylindol-3-yl)methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cn(C)c3ccccc23)S/C1=N/c1nnc(C)s1 |
| InChI | InChI=1S/C18H17N5OS2/c1-4-23-16(24)15(26-18(23)19-17-21-20-11(2)25-17)9-12-10-22(3)14-8-6-5-7-13(12)14/h5-10H,4H2,1-3H3/b15-9-,19-18+ |
| InChIKey | JRJRAVPVITXJST-WRFRESGHSA-N |
| XLogP | 3.96 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|