C13H11N5OS2 — CID 18845799
(2E,5Z)-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 18845799) has the molecular formula C13H11N5OS2 and a molecular weight of 317.40 g/mol. Its IUPAC name is (2E,5Z)-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845799 |
| Molecular Formula | C13H11N5OS2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (2E,5Z)-3-methyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | Cc1nnc(/N=C2/S/C(=C\c3cccnc3)C(=O)N2C)s1 |
| InChI | InChI=1S/C13H11N5OS2/c1-8-16-17-12(20-8)15-13-18(2)11(19)10(21-13)6-9-4-3-5-14-7-9/h3-7H,1-2H3/b10-6-,15-13+ |
| InChIKey | WKOBGMOVRMSXAP-SHFOXUSYSA-N |
| XLogP | 2.48 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|