C16H16N4OS — CID 18842279
(5E)-3-ethyl-5-[(1-methylpyrrol-2-yl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one (PubChem CID 18842279) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[(1-methylpyrrol-2-yl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-[(1-methylpyrrol-2-yl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842279 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (5E)-3-ethyl-5-[(1-methylpyrrol-2-yl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cccn2C)S/C1=N/c1cccnc1 |
| InChI | InChI=1S/C16H16N4OS/c1-3-20-15(21)14(10-13-7-5-9-19(13)2)22-16(20)18-12-6-4-8-17-11-12/h4-11H,3H2,1-2H3/b14-10+,18-16+ |
| InChIKey | ZYSYOJRMMFSLJU-WVTXTPTHSA-N |
| XLogP | 3.04 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|