C25H22N4OS — CID 126105695
(5Z)-3-[2-(1H-indol-3-yl)ethyl]-5-[(1-methylpyrrol-2-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126105695) has the molecular formula C25H22N4OS and a molecular weight of 426.55 g/mol. Its IUPAC name is (5Z)-3-[2-(1H-indol-3-yl)ethyl]-5-[(1-methylpyrrol-2-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[2-(1H-indol-3-yl)ethyl]-5-[(1-methylpyrrol-2-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126105695 |
| Molecular Formula | C25H22N4OS |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (5Z)-3-[2-(1H-indol-3-yl)ethyl]-5-[(1-methylpyrrol-2-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | Cn1cccc1/C=C1\S/C(=N\c2ccccc2)N(CCc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C25H22N4OS/c1-28-14-7-10-20(28)16-23-24(30)29(25(31-23)27-19-8-3-2-4-9-19)15-13-18-17-26-22-12-6-5-11-21(18)22/h2-12,14,16-17,26H,13,15H2,1H3/b23-16-,27-25- |
| InChIKey | QJYSKMPXHUMDEM-WOARFCOISA-N |
| XLogP | 5.35 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|