C27H21N3O3S — CID 3971998
4-[[3-[2-(1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 3971998) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-[[3-[2-(1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 4-[[3-[2-(1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 3971998 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-[[3-[2-(1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C2S/C(=N\c3ccccc3)N(CCc3c[nH]c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C27H21N3O3S/c31-25-24(16-18-10-12-19(13-11-18)26(32)33)34-27(29-21-6-2-1-3-7-21)30(25)15-14-20-17-28-23-9-5-4-8-22(20)23/h1-13,16-17,28H,14-15H2,(H,32,33)/b24-16?,29-27- |
| InChIKey | GZYUGJCRUVPNRJ-LAVRLQIKSA-N |
| XLogP | 5.71 |
| TPSA | 85.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|