C32H25N3O5S — CID 4320349
5-[[4-[[3-[2-(1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 4320349) has the molecular formula C32H25N3O5S and a molecular weight of 563.64 g/mol. Its IUPAC name is 5-[[4-[[3-[2-(1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[[3-[2-(1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 4320349 |
| Molecular Formula | C32H25N3O5S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 5-[[4-[[3-[2-(1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(COc2ccc(C=C3S/C(=N\c4ccccc4)N(CCc4c[nH]c5ccccc45)C3=O)cc2)o1 |
| InChI | InChI=1S/C32H25N3O5S/c36-30-29(18-21-10-12-24(13-11-21)39-20-25-14-15-28(40-25)31(37)38)41-32(34-23-6-2-1-3-7-23)35(30)17-16-22-19-33-27-9-5-4-8-26(22)27/h1-15,18-19,33H,16-17,20H2,(H,37,38)/b29-18?,34-32- |
| InChIKey | JAANTCNCKNAOKP-NNSAGAGBSA-N |
| XLogP | 6.88 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|