C32H28N4O2S — CID 50856952
(5Z)-3-[2-(1H-indol-3-yl)ethyl]-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50856952) has the molecular formula C32H28N4O2S and a molecular weight of 532.67 g/mol. Its IUPAC name is (5Z)-3-[2-(1H-indol-3-yl)ethyl]-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[2-(1H-indol-3-yl)ethyl]-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50856952 |
| Molecular Formula | C32H28N4O2S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | (5Z)-3-[2-(1H-indol-3-yl)ethyl]-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-n2c(C)ccc2/C=C2\S/C(=N\c3ccccc3)N(CCc3c[nH]c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C32H28N4O2S/c1-22-12-13-26(36(22)25-14-16-27(38-2)17-15-25)20-30-31(37)35(32(39-30)34-24-8-4-3-5-9-24)19-18-23-21-33-29-11-7-6-10-28(23)29/h3-17,20-21,33H,18-19H2,1-2H3/b30-20-,34-32- |
| InChIKey | KNQCBKWMAGDRNJ-JXNKHVOESA-N |
| XLogP | 7.12 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|