C35H35ClN4O2S — CID 50860983
(5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 50860983) has the molecular formula C35H35ClN4O2S and a molecular weight of 611.21 g/mol. Its IUPAC name is (5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50860983 |
| Molecular Formula | C35H35ClN4O2S |
| Molecular Weight | 611.21 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | (5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1c2cc(Cl)c(/C=C3/S/C(=N\c4ccc(OC)cc4)N(CCc4c[nH]c5ccccc45)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C35H35ClN4O2S/c1-6-40-31-19-29(36)24(17-28(31)22(2)20-35(40,3)4)18-32-33(41)39(16-15-23-21-37-30-10-8-7-9-27(23)30)34(43-32)38-25-11-13-26(42-5)14-12-25/h7-14,17-21,37H,6,15-16H2,1-5H3/b32-18+,38-34- |
| InChIKey | WBAPVYGRRZWFSB-BQQVRUFISA-N |
| XLogP | 8.70 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.21 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|