C37H42N4O3S — CID 50862945
(5E)-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50862945) has the molecular formula C37H42N4O3S and a molecular weight of 622.84 g/mol. Its IUPAC name is (5E)-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50862945 |
| Molecular Formula | C37H42N4O3S |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | (5E)-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-5-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(OC)c(/C=C3/S/C(=N\c4ccc(OC)cc4)N(CCc4c[nH]c5ccccc45)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C37H42N4O3S/c1-7-17-41-32-21-33(44-6)26(19-30(32)24(2)22-37(41,3)4)20-34-35(42)40(18-16-25-23-38-31-11-9-8-10-29(25)31)36(45-34)39-27-12-14-28(43-5)15-13-27/h8-15,19-21,23-24,38H,7,16-18,22H2,1-6H3/b34-20+,39-36- |
| InChIKey | XMDFRCMEJSGZKR-KTTCQSKFSA-N |
| XLogP | 8.53 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|