C31H30N4O2S — CID 3434872
3-[2-(1H-indol-3-yl)ethyl]-5-[(2-methoxy-4-pyrrolidin-1-ylphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 3434872) has the molecular formula C31H30N4O2S and a molecular weight of 522.67 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)ethyl]-5-[(2-methoxy-4-pyrrolidin-1-ylphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(1H-indol-3-yl)ethyl]-5-[(2-methoxy-4-pyrrolidin-1-ylphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3434872 |
| Molecular Formula | C31H30N4O2S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)ethyl]-5-[(2-methoxy-4-pyrrolidin-1-ylphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(N2CCCC2)ccc1C=C1S/C(=N\c2ccccc2)N(CCc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C31H30N4O2S/c1-37-28-20-25(34-16-7-8-17-34)14-13-22(28)19-29-30(36)35(31(38-29)33-24-9-3-2-4-10-24)18-15-23-21-32-27-12-6-5-11-26(23)27/h2-6,9-14,19-21,32H,7-8,15-18H2,1H3/b29-19?,33-31- |
| InChIKey | HXKXQQVYEMMREV-AIZYIBKVSA-N |
| XLogP | 6.62 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|