C28H27N3O2S — CID 126238133
(5Z)-5-[(2-methoxy-4-piperidin-1-ylphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126238133) has the molecular formula C28H27N3O2S and a molecular weight of 469.61 g/mol. Its IUPAC name is (5Z)-5-[(2-methoxy-4-piperidin-1-ylphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2-methoxy-4-piperidin-1-ylphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126238133 |
| Molecular Formula | C28H27N3O2S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (5Z)-5-[(2-methoxy-4-piperidin-1-ylphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(N2CCCCC2)ccc1/C=C1\S/C(=N\c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C28H27N3O2S/c1-33-25-20-24(30-17-9-4-10-18-30)16-15-21(25)19-26-27(32)31(23-13-7-3-8-14-23)28(34-26)29-22-11-5-2-6-12-22/h2-3,5-8,11-16,19-20H,4,9-10,17-18H2,1H3/b26-19-,29-28- |
| InChIKey | GKLSZUAYQDBXOB-DSTPSKMHSA-N |
| XLogP | 6.49 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|