C23H16Br2N2O3S — CID 4162355
5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 4162355) has the molecular formula C23H16Br2N2O3S and a molecular weight of 560.27 g/mol. Its IUPAC name is 5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4162355 |
| Molecular Formula | C23H16Br2N2O3S |
| Molecular Weight | 560.27 g/mol |
| Exact Mass | 557.92 |
| IUPAC Name | 5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C=C2S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C23H16Br2N2O3S/c1-30-17-12-14(19(24)20(25)21(17)28)13-18-22(29)27(16-10-6-3-7-11-16)23(31-18)26-15-8-4-2-5-9-15/h2-13,28H,1H3/b18-13?,26-23- |
| InChIKey | SZMDEBCBDFUOEH-PSLYGIILSA-N |
| XLogP | 6.73 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.27 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|