C24H17BrN2O4S — CID 2858270
2-[4-bromo-2-[(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid (PubChem CID 2858270) has the molecular formula C24H17BrN2O4S and a molecular weight of 509.38 g/mol. Its IUPAC name is 2-[4-bromo-2-[(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-bromo-2-[(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 2858270 |
| Molecular Formula | C24H17BrN2O4S |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 2-[4-bromo-2-[(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Br)cc1C=C1S/C(=N\c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H17BrN2O4S/c25-17-11-12-20(31-15-22(28)29)16(13-17)14-21-23(30)27(19-9-5-2-6-10-19)24(32-21)26-18-7-3-1-4-8-18/h1-14H,15H2,(H,28,29)/b21-14?,26-24- |
| InChIKey | UPJWBCCGZYEWRF-YQECMLSGSA-N |
| XLogP | 5.72 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|