C23H23BrN2O5S — CID 4204115
methyl 2-[4-bromo-2-[[3-(3-methoxypropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 4204115) has the molecular formula C23H23BrN2O5S and a molecular weight of 519.42 g/mol. Its IUPAC name is methyl 2-[4-bromo-2-[[3-(3-methoxypropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-bromo-2-[[3-(3-methoxypropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4204115 |
| Molecular Formula | C23H23BrN2O5S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | methyl 2-[4-bromo-2-[[3-(3-methoxypropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COCCCN1C(=O)C(=Cc2cc(Br)ccc2OCC(=O)OC)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C23H23BrN2O5S/c1-29-12-6-11-26-22(28)20(32-23(26)25-18-7-4-3-5-8-18)14-16-13-17(24)9-10-19(16)31-15-21(27)30-2/h3-5,7-10,13-14H,6,11-12,15H2,1-2H3/b20-14?,25-23- |
| InChIKey | WWVSYHFWZRURDS-BXXGMMJLSA-N |
| XLogP | 4.64 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|