C24H18Br2N2O2S — CID 126093328
(5E)-5-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126093328) has the molecular formula C24H18Br2N2O2S and a molecular weight of 558.30 g/mol. Its IUPAC name is (5E)-5-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126093328 |
| Molecular Formula | C24H18Br2N2O2S |
| Molecular Weight | 558.30 g/mol |
| Exact Mass | 555.95 |
| IUPAC Name | (5E)-5-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1c(Br)cc(Br)cc1/C=C1/S/C(=N\c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H18Br2N2O2S/c1-2-30-22-16(13-17(25)15-20(22)26)14-21-23(29)28(19-11-7-4-8-12-19)24(31-21)27-18-9-5-3-6-10-18/h3-15H,2H2,1H3/b21-14+,27-24- |
| InChIKey | XQBYUIBYEATMNO-ZDGMEELJSA-N |
| XLogP | 7.42 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.30 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|