C22H14BrClN2O2S — CID 2858828
5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 2858828) has the molecular formula C22H14BrClN2O2S and a molecular weight of 485.79 g/mol. Its IUPAC name is 5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2858828 |
| Molecular Formula | C22H14BrClN2O2S |
| Molecular Weight | 485.79 g/mol |
| Exact Mass | 483.96 |
| IUPAC Name | 5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cc(Cl)cc(Br)c2O)S/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H14BrClN2O2S/c23-18-13-15(24)11-14(20(18)27)12-19-21(28)26(17-9-5-2-6-10-17)22(29-19)25-16-7-3-1-4-8-16/h1-13,27H/b19-12?,25-22- |
| InChIKey | QCNAGVGULGKBBF-KXMSCHDYSA-N |
| XLogP | 6.62 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|