C31H29FN4O3S — CID 126153215
(5Z)-5-[(3-fluoro-4-morpholin-4-ylphenyl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126153215) has the molecular formula C31H29FN4O3S and a molecular weight of 556.66 g/mol. Its IUPAC name is (5Z)-5-[(3-fluoro-4-morpholin-4-ylphenyl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-fluoro-4-morpholin-4-ylphenyl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126153215 |
| Molecular Formula | C31H29FN4O3S |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | (5Z)-5-[(3-fluoro-4-morpholin-4-ylphenyl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\S/C(=C\c3ccc(N4CCOCC4)c(F)c3)C(=O)N2CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C31H29FN4O3S/c1-38-24-9-7-23(8-10-24)34-31-36(13-12-22-20-33-27-5-3-2-4-25(22)27)30(37)29(40-31)19-21-6-11-28(26(32)18-21)35-14-16-39-17-15-35/h2-11,18-20,33H,12-17H2,1H3/b29-19-,34-31- |
| InChIKey | UMADNKVGFNWABN-WHBJKMDHSA-N |
| XLogP | 6.00 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|