C36H39ClN4O2S — CID 50860981
(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 50860981) has the molecular formula C36H39ClN4O2S and a molecular weight of 627.25 g/mol. Its IUPAC name is (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50860981 |
| Molecular Formula | C36H39ClN4O2S |
| Molecular Weight | 627.25 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(Cl)c(/C=C3/S/C(=N\c4ccc(OC)cc4)N(CCc4c[nH]c5ccccc45)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C36H39ClN4O2S/c1-6-16-41-32-20-30(37)25(18-29(32)23(2)21-36(41,3)4)19-33-34(42)40(17-15-24-22-38-31-10-8-7-9-28(24)31)35(44-33)39-26-11-13-27(43-5)14-12-26/h7-14,18-20,22-23,38H,6,15-17,21H2,1-5H3/b33-19+,39-35- |
| InChIKey | UQQXPOPOHFNPDR-AJABQHCKSA-N |
| XLogP | 9.18 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.25 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|