C30H32ClN3O3S — CID 50860960
(5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 50860960) has the molecular formula C30H32ClN3O3S and a molecular weight of 550.12 g/mol. Its IUPAC name is (5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50860960 |
| Molecular Formula | C30H32ClN3O3S |
| Molecular Weight | 550.12 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | (5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1c2cc(Cl)c(/C=C3/S/C(=N\c4ccc(OC)cc4)N(Cc4ccco4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C30H32ClN3O3S/c1-6-34-26-16-25(31)20(14-24(26)19(2)17-30(34,3)4)15-27-28(35)33(18-23-8-7-13-37-23)29(38-27)32-21-9-11-22(36-5)12-10-21/h7-16,19H,6,17-18H2,1-5H3/b27-15+,32-29- |
| InChIKey | SLODUPKFIFJIEL-AEGCNQERSA-N |
| XLogP | 7.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.12 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|