C28H28N4OS — CID 126076193
(5Z)-5-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126076193) has the molecular formula C28H28N4OS and a molecular weight of 468.63 g/mol. Its IUPAC name is (5Z)-5-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126076193 |
| Molecular Formula | C28H28N4OS |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (5Z)-5-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-[2-(1H-indol-3-yl)ethyl]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCn1c(C)cc(/C=C2\S/C(=N\c3ccccc3)N(CCc3c[nH]c4ccccc34)C2=O)c1C |
| InChI | InChI=1S/C28H28N4OS/c1-4-31-19(2)16-22(20(31)3)17-26-27(33)32(28(34-26)30-23-10-6-5-7-11-23)15-14-21-18-29-25-13-9-8-12-24(21)25/h5-13,16-18,29H,4,14-15H2,1-3H3/b26-17-,30-28- |
| InChIKey | WWMNQBYYAUAOTI-DUPRQXJUSA-N |
| XLogP | 6.45 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|