C28H23N3O2S — CID 50856451
(5Z)-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50856451) has the molecular formula C28H23N3O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is (5Z)-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50856451 |
| Molecular Formula | C28H23N3O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (5Z)-5-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-n2c(C)ccc2/C=C2\S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H23N3O2S/c1-20-13-14-24(30(20)23-15-17-25(33-2)18-16-23)19-26-27(32)31(22-11-7-4-8-12-22)28(34-26)29-21-9-5-3-6-10-21/h3-19H,1-2H3/b26-19-,29-28- |
| InChIKey | RUAJXFSSFMXGBW-DSTPSKMHSA-N |
| XLogP | 6.60 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|