C32H24N4O2S — CID 3453388
5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 3453388) has the molecular formula C32H24N4O2S and a molecular weight of 528.64 g/mol. Its IUPAC name is 5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3453388 |
| Molecular Formula | C32H24N4O2S |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=C2S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C32H24N4O2S/c1-38-28-19-17-23(18-20-28)30-24(22-35(34-30)26-13-7-3-8-14-26)21-29-31(37)36(27-15-9-4-10-16-27)32(39-29)33-25-11-5-2-6-12-25/h2-22H,1H3/b29-21?,33-32- |
| InChIKey | CGTBEJCKMSTQSD-NYUAMNGBSA-N |
| XLogP | 7.36 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|