C26H20N4O3S — CID 135782371
(5Z)-4-(3-hydroxyphenyl)imino-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-2-one (PubChem CID 135782371) has the molecular formula C26H20N4O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is (5Z)-4-(3-hydroxyphenyl)imino-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-4-(3-hydroxyphenyl)imino-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135782371 |
| Molecular Formula | C26H20N4O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (5Z)-4-(3-hydroxyphenyl)imino-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\SC(=O)N\C2=N/c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C26H20N4O3S/c1-33-22-12-10-17(11-13-22)24-18(16-30(29-24)20-7-3-2-4-8-20)14-23-25(28-26(32)34-23)27-19-6-5-9-21(31)15-19/h2-16,31H,1H3,(H,27,28,32)/b23-14- |
| InChIKey | HRLVFEXMYJGEIR-UCQKPKSFSA-N |
| XLogP | 5.78 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|