C27H22N4O3S — CID 135834393
(5Z)-2-(2-hydroxy-6-methylphenyl)imino-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135834393) has the molecular formula C27H22N4O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is (5Z)-2-(2-hydroxy-6-methylphenyl)imino-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2-hydroxy-6-methylphenyl)imino-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135834393 |
| Molecular Formula | C27H22N4O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (5Z)-2-(2-hydroxy-6-methylphenyl)imino-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\S/C(=N\c3c(C)cccc3O)NC2=O)cc1 |
| InChI | InChI=1S/C27H22N4O3S/c1-17-7-6-10-22(32)24(17)28-27-29-26(33)23(35-27)15-19-16-31(20-8-4-3-5-9-20)30-25(19)18-11-13-21(34-2)14-12-18/h3-16,32H,1-2H3,(H,28,29,33)/b23-15- |
| InChIKey | HLXZDLJZAWFQOL-HAHDFKILSA-N |
| XLogP | 5.45 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|