C27H21N5O2S — CID 135413169
2-(benzylidenehydrazinylidene)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135413169) has the molecular formula C27H21N5O2S and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-(benzylidenehydrazinylidene)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(benzylidenehydrazinylidene)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135413169 |
| Molecular Formula | C27H21N5O2S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-(benzylidenehydrazinylidene)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=C2SC(=NN=Cc3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C27H21N5O2S/c1-34-23-14-12-20(13-15-23)25-21(18-32(31-25)22-10-6-3-7-11-22)16-24-26(33)29-27(35-24)30-28-17-19-8-4-2-5-9-19/h2-18H,1H3,(H,29,30,33) |
| InChIKey | BBJPEMAKXQWCFG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|