C26H20N4O2S — CID 135782375
(5Z)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-phenylimino-1,3-thiazolidin-2-one (PubChem CID 135782375) has the molecular formula C26H20N4O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is (5Z)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-phenylimino-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-phenylimino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135782375 |
| Molecular Formula | C26H20N4O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (5Z)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-phenylimino-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\SC(=O)N\C2=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N4O2S/c1-32-22-14-12-18(13-15-22)24-19(17-30(29-24)21-10-6-3-7-11-21)16-23-25(28-26(31)33-23)27-20-8-4-2-5-9-20/h2-17H,1H3,(H,27,28,31)/b23-16- |
| InChIKey | UKMSLCJHZFNCNU-KQWNVCNZSA-N |
| XLogP | 6.08 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|