C25H17ClN4OS — CID 166610900
(5Z)-2-(4-chlorophenyl)imino-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 166610900) has the molecular formula C25H17ClN4OS and a molecular weight of 456.96 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 166610900 |
| Molecular Formula | C25H17ClN4OS |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2)S/C1=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H17ClN4OS/c26-19-11-13-20(14-12-19)27-25-28-24(31)22(32-25)15-18-16-30(21-9-5-2-6-10-21)29-23(18)17-7-3-1-4-8-17/h1-16H,(H,27,28,31)/b22-15- |
| InChIKey | JZRIUOJJSOSWLH-JCMHNJIXSA-N |
| XLogP | 6.08 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|