C28H23N3O3S2 — CID 6066803
(5E)-3-(4-ethoxyphenyl)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 6066803) has the molecular formula C28H23N3O3S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is (5E)-3-(4-ethoxyphenyl)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | (5E)-3-(4-ethoxyphenyl)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 6066803 |
| Molecular Formula | C28H23N3O3S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | (5E)-3-(4-ethoxyphenyl)-5-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | CCOc1ccc(N2C(=O)S/C(=C/c3cn(-c4ccccc4)nc3-c3ccc(OC)cc3)C2=S)cc1 |
| InChI | InChI=1S/C28H23N3O3S2/c1-3-34-24-15-11-22(12-16-24)31-27(35)25(36-28(31)32)17-20-18-30(21-7-5-4-6-8-21)29-26(20)19-9-13-23(33-2)14-10-19/h4-18H,3H2,1-2H3/b25-17+ |
| InChIKey | JCXQSLGJBNVAQS-KOEQRZSOSA-N |
| XLogP | 6.99 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|