C30H26N4O2S — CID 4704564
5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2-(4-ethoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 4704564) has the molecular formula C30H26N4O2S and a molecular weight of 506.63 g/mol. Its IUPAC name is 5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2-(4-ethoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2-(4-ethoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4704564 |
| Molecular Formula | C30H26N4O2S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2-(4-ethoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2ccccc2)S/C1=N/c1ccc(OCC)cc1 |
| InChI | InChI=1S/C30H26N4O2S/c1-3-19-33-29(35)27(37-30(33)31-24-15-17-26(18-16-24)36-4-2)20-23-21-34(25-13-9-6-10-14-25)32-28(23)22-11-7-5-8-12-22/h3,5-18,20-21H,1,4,19H2,2H3/b27-20?,31-30+ |
| InChIKey | YGCYYTQRWHEQHN-UQSKAVNDSA-N |
| XLogP | 6.73 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|