C36H30N4O2S — CID 18807059
(5Z)-5-[[4-(3,5-diphenylpyrazol-1-yl)phenyl]methylidene]-2-(4-ethoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18807059) has the molecular formula C36H30N4O2S and a molecular weight of 582.73 g/mol. Its IUPAC name is (5Z)-5-[[4-(3,5-diphenylpyrazol-1-yl)phenyl]methylidene]-2-(4-ethoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(3,5-diphenylpyrazol-1-yl)phenyl]methylidene]-2-(4-ethoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18807059 |
| Molecular Formula | C36H30N4O2S |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | (5Z)-5-[[4-(3,5-diphenylpyrazol-1-yl)phenyl]methylidene]-2-(4-ethoxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(-n3nc(-c4ccccc4)cc3-c3ccccc3)cc2)S/C1=N/c1ccc(OCC)cc1 |
| InChI | InChI=1S/C36H30N4O2S/c1-3-23-39-35(41)34(43-36(39)37-29-17-21-31(22-18-29)42-4-2)24-26-15-19-30(20-16-26)40-33(28-13-9-6-10-14-28)25-32(38-40)27-11-7-5-8-12-27/h3,5-22,24-25H,1,4,23H2,2H3/b34-24-,37-36+ |
| InChIKey | GTSIJSCIPMTQAV-ZUXXOQSWSA-N |
| XLogP | 8.40 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|