C27H23N2O4S- — CID 2185782
2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 2185782) has the molecular formula C27H23N2O4S- and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2185782 |
| Molecular Formula | C27H23N2O4S- |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-[4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | Cc1ccc(/N=C2/S/C(=C\c3ccc(OCC(=O)[O-])cc3)C(=O)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N2O4S/c1-19-7-11-22(12-8-19)28-27-29(16-15-20-5-3-2-4-6-20)26(32)24(34-27)17-21-9-13-23(14-10-21)33-18-25(30)31/h2-14,17H,15-16,18H2,1H3,(H,30,31)/p-1/b24-17-,28-27+ |
| InChIKey | XBQIUYGPPYLNIS-XUXMYZBRSA-M |
| XLogP | 3.97 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|