C30H26N2O2S — CID 124668759
(5E)-5-[(4-methoxynaphthalen-1-yl)methylidene]-2-(4-methylphenyl)imino-3-(2-phenylethyl)-1,3-thiazolidin-4-one (PubChem CID 124668759) has the molecular formula C30H26N2O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is (5E)-5-[(4-methoxynaphthalen-1-yl)methylidene]-2-(4-methylphenyl)imino-3-(2-phenylethyl)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-methoxynaphthalen-1-yl)methylidene]-2-(4-methylphenyl)imino-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 124668759 |
| Molecular Formula | C30H26N2O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (5E)-5-[(4-methoxynaphthalen-1-yl)methylidene]-2-(4-methylphenyl)imino-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2/S/C(=N\c3ccc(C)cc3)N(CCc3ccccc3)C2=O)c2ccccc12 |
| InChI | InChI=1S/C30H26N2O2S/c1-21-12-15-24(16-13-21)31-30-32(19-18-22-8-4-3-5-9-22)29(33)28(35-30)20-23-14-17-27(34-2)26-11-7-6-10-25(23)26/h3-17,20H,18-19H2,1-2H3/b28-20+,31-30- |
| InChIKey | AQFPFTDORUSGFG-FHANCIAUSA-N |
| XLogP | 7.00 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|