C30H29N3OS — CID 126165433
(5E)-2-(4-methylphenyl)imino-3-(2-phenylethyl)-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126165433) has the molecular formula C30H29N3OS and a molecular weight of 479.65 g/mol. Its IUPAC name is (5E)-2-(4-methylphenyl)imino-3-(2-phenylethyl)-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-methylphenyl)imino-3-(2-phenylethyl)-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126165433 |
| Molecular Formula | C30H29N3OS |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (5E)-2-(4-methylphenyl)imino-3-(2-phenylethyl)-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\S/C(=C/c3cn(C(C)C)c4ccccc34)C(=O)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N3OS/c1-21(2)33-20-24(26-11-7-8-12-27(26)33)19-28-29(34)32(18-17-23-9-5-4-6-10-23)30(35-28)31-25-15-13-22(3)14-16-25/h4-16,19-21H,17-18H2,1-3H3/b28-19+,31-30- |
| InChIKey | VAQMCVDLBMQUGT-HQAJQCFLSA-N |
| XLogP | 7.38 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|