C15H13ClN4OS — CID 18843721
(5E)-2-[(3-chloro-4-pyridinyl)imino]-3-methyl-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18843721) has the molecular formula C15H13ClN4OS and a molecular weight of 332.82 g/mol. Its IUPAC name is (5E)-2-[(3-chloro-4-pyridinyl)imino]-3-methyl-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[(3-chloro-4-pyridinyl)imino]-3-methyl-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843721 |
| Molecular Formula | C15H13ClN4OS |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (5E)-2-[(3-chloro-4-pyridinyl)imino]-3-methyl-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2cccn2C)S/C1=N/c1ccncc1Cl |
| InChI | InChI=1S/C15H13ClN4OS/c1-19-7-3-4-10(19)8-13-14(21)20(2)15(22-13)18-12-5-6-17-9-11(12)16/h3-9H,1-2H3/b13-8+,18-15+ |
| InChIKey | WHQHOWACZQTXRO-JSVSDUBLSA-N |
| XLogP | 3.31 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|