C23H19ClN4O2S2 — CID 18845938
(2E,5Z)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18845938) has the molecular formula C23H19ClN4O2S2 and a molecular weight of 483.02 g/mol. Its IUPAC name is (2E,5Z)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845938 |
| Molecular Formula | C23H19ClN4O2S2 |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | (2E,5Z)-5-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2cccc(OCc3ccc(Cl)cc3)c2)S/C1=N/c1nnc(C)s1 |
| InChI | InChI=1S/C23H19ClN4O2S2/c1-3-11-28-21(29)20(32-23(28)25-22-27-26-15(2)31-22)13-17-5-4-6-19(12-17)30-14-16-7-9-18(24)10-8-16/h3-10,12-13H,1,11,14H2,2H3/b20-13-,25-23+ |
| InChIKey | BCIIRURISJQGDD-DMDNQVQLSA-N |
| XLogP | 5.87 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|