C19H19ClN4OS2 — CID 7559814
(5E)-5-[(4-chlorophenyl)methylidene]-2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]imino]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 7559814) has the molecular formula C19H19ClN4OS2 and a molecular weight of 418.98 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]imino]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7559814 |
| Molecular Formula | C19H19ClN4OS2 |
| Molecular Weight | 418.98 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(Cl)cc2)SC1=Nc1nnc(CC(C)C)s1 |
| InChI | InChI=1S/C19H19ClN4OS2/c1-4-9-24-17(25)15(11-13-5-7-14(20)8-6-13)26-19(24)21-18-23-22-16(27-18)10-12(2)3/h4-8,11-12H,1,9-10H2,2-3H3/b15-11+,21-19? |
| InChIKey | YOHOPRTYKCQVEF-XXSZMANFSA-N |
| XLogP | 5.18 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.98 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|