C17H16ClN5OS2 — CID 6390528
(2Z,5E)-5-[(4-chlorophenyl)methylidene]-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)imino]-3-(prop-2-enylamino)-1,3-thiazolidin-4-one (PubChem CID 6390528) has the molecular formula C17H16ClN5OS2 and a molecular weight of 405.94 g/mol. Its IUPAC name is (2Z,5E)-5-[(4-chlorophenyl)methylidene]-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)imino]-3-(prop-2-enylamino)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5E)-5-[(4-chlorophenyl)methylidene]-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)imino]-3-(prop-2-enylamino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6390528 |
| Molecular Formula | C17H16ClN5OS2 |
| Molecular Weight | 405.94 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (2Z,5E)-5-[(4-chlorophenyl)methylidene]-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)imino]-3-(prop-2-enylamino)-1,3-thiazolidin-4-one |
| SMILES | C=CCNN1C(=O)/C(=C\c2ccc(Cl)cc2)S/C1=N\c1nnc(CC)s1 |
| InChI | InChI=1S/C17H16ClN5OS2/c1-3-9-19-23-15(24)13(10-11-5-7-12(18)8-6-11)25-17(23)20-16-22-21-14(4-2)26-16/h3,5-8,10,19H,1,4,9H2,2H3/b13-10+,20-17- |
| InChIKey | HEGMCPPDDQNLRK-MMXKDLEISA-N |
| XLogP | 4.05 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.94 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|