C22H18N4O2S2 — CID 18846082
(2E,5Z)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-phenyl-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18846082) has the molecular formula C22H18N4O2S2 and a molecular weight of 434.55 g/mol. Its IUPAC name is (2E,5Z)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-phenyl-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-phenyl-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18846082 |
| Molecular Formula | C22H18N4O2S2 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (2E,5Z)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-3-phenyl-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1ccc(/C=C2\S/C(=N/c3nnc(C)s3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H18N4O2S2/c1-3-13-28-18-11-9-16(10-12-18)14-19-20(27)26(17-7-5-4-6-8-17)22(30-19)23-21-25-24-15(2)29-21/h3-12,14H,1,13H2,2H3/b19-14-,23-22+ |
| InChIKey | SUBAOJJBPKJFKA-UVOXWLTBSA-N |
| XLogP | 5.22 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|