C20H21N3O4S2 — CID 43862865
2-[2-[(E)-[(2E)-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid (PubChem CID 43862865) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[2-[(E)-[(2E)-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-[(E)-[(2E)-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 43862865 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-[2-[(E)-[(2E)-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccccc1/C=C1/S/C(=N/c2nc(C)cs2)N(CC)C1=O)C(=O)O |
| InChI | InChI=1S/C20H21N3O4S2/c1-4-14(18(25)26)27-15-9-7-6-8-13(15)10-16-17(24)23(5-2)20(29-16)22-19-21-12(3)11-28-19/h6-11,14H,4-5H2,1-3H3,(H,25,26)/b16-10+,22-20+ |
| InChIKey | WYHYPIMFSAOLFV-MOOWDGFTSA-N |
| XLogP | 4.32 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|