C23H27N3O5S2 — CID 43863611
2-[2-ethoxy-4-[(E)-[(2E)-2-[(4-methyl-1,3-thiazol-2-yl)imino]-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid (PubChem CID 43863611) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[(2E)-2-[(4-methyl-1,3-thiazol-2-yl)imino]-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-ethoxy-4-[(E)-[(2E)-2-[(4-methyl-1,3-thiazol-2-yl)imino]-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 43863611 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[(2E)-2-[(4-methyl-1,3-thiazol-2-yl)imino]-4-oxo-3-propyl-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
| SMILES | CCCN1C(=O)/C(=C\c2ccc(OC(CC)C(=O)O)c(OCC)c2)S/C1=N/c1nc(C)cs1 |
| InChI | InChI=1S/C23H27N3O5S2/c1-5-10-26-20(27)19(33-23(26)25-22-24-14(4)13-32-22)12-15-8-9-17(18(11-15)30-7-3)31-16(6-2)21(28)29/h8-9,11-13,16H,5-7,10H2,1-4H3,(H,28,29)/b19-12+,25-23+ |
| InChIKey | ACDJNIRZZHEETK-VTNZUCANSA-N |
| XLogP | 5.11 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|