C18H17N3OS2 — CID 18844864
(2E,5Z)-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 18844864) has the molecular formula C18H17N3OS2 and a molecular weight of 355.49 g/mol. Its IUPAC name is (2E,5Z)-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844864 |
| Molecular Formula | C18H17N3OS2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (2E,5Z)-3-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/C=C/c2ccccc2)S/C1=N/c1nc(C)cs1 |
| InChI | InChI=1S/C18H17N3OS2/c1-3-21-16(22)15(11-7-10-14-8-5-4-6-9-14)24-18(21)20-17-19-13(2)12-23-17/h4-12H,3H2,1-2H3/b10-7+,15-11-,20-18+ |
| InChIKey | OAWWSKJDVJEJDM-IRQDVWSSSA-N |
| XLogP | 4.63 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|