C24H19N3OS — CID 1231522
(5Z)-2-phenylimino-5-[(E)-3-phenylprop-2-enylidene]-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 1231522) has the molecular formula C24H19N3OS and a molecular weight of 397.50 g/mol. Its IUPAC name is (5Z)-2-phenylimino-5-[(E)-3-phenylprop-2-enylidene]-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-phenylimino-5-[(E)-3-phenylprop-2-enylidene]-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1231522 |
| Molecular Formula | C24H19N3OS |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (5Z)-2-phenylimino-5-[(E)-3-phenylprop-2-enylidene]-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/C=C/c2ccccc2)S/C(=N\c2ccccc2)N1Cc1cccnc1 |
| InChI | InChI=1S/C24H19N3OS/c28-23-22(15-7-11-19-9-3-1-4-10-19)29-24(26-21-13-5-2-6-14-21)27(23)18-20-12-8-16-25-17-20/h1-17H,18H2/b11-7+,22-15-,26-24- |
| InChIKey | WJYLPPMQSAGZBI-FWJGGVBESA-N |
| XLogP | 5.44 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|