C23H17N3O3S — CID 56691666
(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 56691666) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 56691666 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc3c(c2)OCO3)S/C(=N\c2ccccc2)N1Cc1cccnc1 |
| InChI | InChI=1S/C23H17N3O3S/c27-22-21(12-16-8-9-19-20(11-16)29-15-28-19)30-23(25-18-6-2-1-3-7-18)26(22)14-17-5-4-10-24-13-17/h1-13H,14-15H2/b21-12-,25-23- |
| InChIKey | QJDNNMKTPDWXHE-XHOZKXSISA-N |
| XLogP | 4.61 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|